CAS 1185292-62-9

Ethyl 2,6-bis(trifluoromethyl)-4-quinolinecarboxylate

Description:

Ethyl 2,6-bis(trifluoromethyl)-4-quinolinecarboxylate is a synthetic organic compound characterized by its quinoline structure, which features a carboxylate functional group and two trifluoromethyl substituents at the 2 and 6 positions of the quinoline ring. This compound is typically a pale yellow solid or liquid, depending on its specific form and purity. The presence of trifluoromethyl groups enhances its lipophilicity and may impart unique electronic properties, making it of interest in various chemical applications, including medicinal chemistry and materials science. Ethyl 2,6-bis(trifluoromethyl)-4-quinolinecarboxylate may exhibit biological activity, potentially serving as a scaffold for the development of pharmaceuticals. Its synthesis often involves multi-step organic reactions, and it is important to handle this compound with care due to the presence of fluorinated groups, which can influence its reactivity and environmental persistence. As with many fluorinated compounds, it may also exhibit unique solubility and stability characteristics in various solvents.

Formula: C₁₄H₉F₆NO₂

InChI: InChI=1S/C14H9F6NO2/c1-2-23-12(22)9-6-11(14(18,19)20)21-10-4-3-7(5-8(9)10)13(15,16)17/h3-6H,2H2,1H3

InChI key: InChIKey=VJSXOEINEVAOIQ-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C2=C(N=C(C(F)(F)F)C1)C=CC(C(F)(F)F)=C2

Synonyms:

• Ethyl 2,6-bis(trifluoromethyl)-4-quinolinecarboxylate
• 4-Quinolinecarboxylic acid, 2,6-bis(trifluoromethyl)-, ethyl ester