CAS 1185292-66-3

2-Pyridinecarboxylic acid, 4-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-, sodium salt (1:1)

Description:

2-Pyridinecarboxylic acid, 4-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-, sodium salt (1:1), also known by its CAS number 1185292-66-3, is a chemical compound characterized by its pyridine ring structure, which contributes to its aromatic properties. This compound features a carboxylic acid functional group, indicating its acidic nature, and a sodium salt form, which enhances its solubility in aqueous solutions. The presence of the dimethylethoxycarbonyl group suggests that it may exhibit protective or modifying characteristics in chemical reactions. The amino group attached to the pyridine ring indicates potential for hydrogen bonding and reactivity, making it useful in various synthetic applications. Additionally, the compound's structure implies potential biological activity, which may be explored in pharmaceutical contexts. Overall, this compound's unique combination of functional groups and structural features positions it as a versatile agent in both organic synthesis and potential medicinal chemistry applications.

Formula: C₁₂H₁₆N₂O₄·Na

InChI: InChI=1S/C12H16N2O4.Na/c1-12(2,3)18-11(17)14-7-8-4-5-13-9(6-8)10(15)16;/h4-6H,7H2,1-3H3,(H,14,17)(H,15,16);

InChI key: InChIKey=UZCSPZPLUVAGLJ-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)C=1C=C(C(O)=O)N=CC1.[Na]

Synonyms:

• 2-Pyridinecarboxylic acid, 4-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-, sodium salt (1:1)