CAS 1185293-24-6

[1,4′-Bipiperidine]-3-carboxylic acid, hydrochloride (1:2)

Description:

[1,4′-Bipiperidine]-3-carboxylic acid, hydrochloride (1:2) is a chemical compound characterized by its bipiperidine structure, which consists of two piperidine rings connected by a carbon chain, with a carboxylic acid functional group at the 3-position. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in organic synthesis and medicinal chemistry. The presence of the carboxylic acid group contributes to its acidic properties, while the bipiperidine framework may impart unique pharmacological activities. The compound's molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the hydrochloride form can influence the compound's stability and bioavailability. As with many chemical substances, handling should be conducted with care, adhering to safety protocols to mitigate any risks associated with its use.

Formula: C₁₁H₂₀N₂O₂·2ClH

InChI: InChI=1S/C11H20N2O2.2ClH/c14-11(15)9-2-1-7-13(8-9)10-3-5-12-6-4-10;;/h9-10,12H,1-8H2,(H,14,15);2*1H

InChI key: InChIKey=QLQIDWZIPJTBJZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CN(CCC1)C2CCNCC2.Cl

Synonyms:

• [1,4′-Bipiperidine]-3-carboxylic acid, hydrochloride (1:2)

[1,4'-Bipiperidine]-3-carboxylic acid dihydrochloride

CAS: 1185293-24-6

Formula: C₁₁H₂₂Cl₂N₂O₂

Molecular weight: 285.2106

Ref: IN-DA00J2DZ