CymitQuimica logo

CAS 1185293-35-9

:

1H-Pyrrole-2-methanamine, 1-methyl-N-[(tetrahydro-2-furanyl)methyl]-, hydrochloride (1:1)

Description:
1H-Pyrrole-2-methanamine, 1-methyl-N-[(tetrahydro-2-furanyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a pyrrole ring and a tetrahydrofuran moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its amine and hydrochloride functionalities. The presence of the pyrrole ring suggests potential applications in pharmaceuticals and organic synthesis, as pyrroles are known for their biological activity and ability to participate in various chemical reactions. The hydrochloride form indicates that it is a salt, which can enhance its stability and solubility in aqueous environments. Additionally, the compound may exhibit properties such as basicity due to the amine group, which can engage in hydrogen bonding and influence its reactivity. Overall, this compound's characteristics make it of interest in medicinal chemistry and materials science, although specific applications would depend on further research and development.
Formula:C11H18N2O·ClH
InChI:InChI=1S/C11H18N2O.ClH/c1-13-6-2-4-10(13)8-12-9-11-5-3-7-14-11;/h2,4,6,11-12H,3,5,7-9H2,1H3;1H
InChI key:InChIKey=HQPFXVLHAGJYTM-UHFFFAOYSA-N
SMILES:C(NCC1CCCO1)C=2N(C)C=CC2.Cl
Synonyms:
  • 1H-Pyrrole-2-methanamine, 1-methyl-N-[(tetrahydro-2-furanyl)methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.