CAS 1185293-44-0

1H-Benzimidazol-5-amine, 1-ethyl-2-(trifluoromethyl)-, hydrochloride (1:2)

Description:

1H-Benzimidazol-5-amine, 1-ethyl-2-(trifluoromethyl)-, hydrochloride (1:2) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. The presence of an ethyl group and a trifluoromethyl group contributes to its unique properties, influencing its solubility and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceuticals. This compound may exhibit biological activity, potentially serving as a scaffold for drug development, particularly in areas such as oncology or infectious diseases. The trifluoromethyl group is known to enhance metabolic stability and lipophilicity, making it a valuable feature in medicinal chemistry. Overall, the characteristics of this compound suggest it may have significant utility in research and development, although specific biological activities and applications would require further investigation.

Formula: C₁₀H₁₀F₃N₃·2ClH

InChI: InChI=1S/C10H10F3N3.2ClH/c1-2-16-8-4-3-6(14)5-7(8)15-9(16)10(11,12)13;;/h3-5H,2,14H2,1H3;2*1H

InChI key: InChIKey=HXNNSUIXQWLDOC-UHFFFAOYSA-N

SMILES: C(C)N1C=2C(N=C1C(F)(F)F)=CC(N)=CC2.Cl

Synonyms:

• 1H-Benzimidazol-5-amine, 1-ethyl-2-(trifluoromethyl)-, hydrochloride (1:2)