CAS 1185293-54-2

1H-Imidazole-1-propanoic acid, 2-ethyl-α-methyl-, hydrochloride (1:1)

Description:

1H-Imidazole-1-propanoic acid, 2-ethyl-α-methyl-, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the imidazole moiety. As a hydrochloride salt, it is likely to be soluble in water, which enhances its bioavailability and potential applications in biological systems. The presence of the ethyl and α-methyl substituents contributes to its steric and electronic properties, potentially influencing its reactivity and interaction with biological targets. This compound may be of interest in pharmaceutical research, particularly in the development of drugs that target specific biological pathways or receptors. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is studied or utilized.

Formula: C₉H₁₄N₂O₂·ClH

InChI: InChI=1S/C9H14N2O2.ClH/c1-3-8-10-4-5-11(8)6-7(2)9(12)13;/h4-5,7H,3,6H2,1-2H3,(H,12,13);1H

InChI key: InChIKey=YLXSCMOWXVRHPC-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)C)N1C(CC)=NC=C1.Cl

Synonyms:

• 1H-Imidazole-1-propanoic acid, 2-ethyl-α-methyl-, hydrochloride (1:1)