CymitQuimica logo

CAS 1185293-56-4

:

1-Piperidineacetamide, 4-amino-, hydrochloride (1:2)

Description:
1-Piperidineacetamide, 4-amino-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of an acetamide group indicates that it has an amide functional group attached to a piperidine, specifically at the 1-position, while the 4-amino designation suggests an amino group is present at the 4-position of the piperidine ring. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. This compound may exhibit biological activity due to its structural features, potentially interacting with biological targets. Its molecular properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and usage, as with any chemical compound, to ensure proper precautions are taken.
Formula:C7H15N3O·2ClH
InChI:InChI=1S/C7H15N3O.2ClH/c8-6-1-3-10(4-2-6)5-7(9)11;;/h6H,1-5,8H2,(H2,9,11);2*1H
InChI key:InChIKey=JHPZILSPZDCEEF-UHFFFAOYSA-N
SMILES:C(C(N)=O)N1CCC(N)CC1.Cl
Synonyms:
  • 1-Piperidineacetamide, 4-amino-, hydrochloride (1:2)
Found 5 products.