CAS 1185293-57-5

4-Pyridinemethanamine, N-[2-(3,4-dimethoxyphenyl)ethyl]-, hydrochloride (1:1)

Description:

4-Pyridinemethanamine, N-[2-(3,4-dimethoxyphenyl)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and amine functional groups, which contribute to its basicity and potential reactivity. The presence of the 3,4-dimethoxyphenyl group enhances its lipophilicity, potentially influencing its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water than its free base form, facilitating its use in various applications, particularly in pharmaceutical formulations. The compound may exhibit biological activity, making it of interest in medicinal chemistry, although specific biological properties would depend on its interaction with biological targets. Its molecular structure suggests potential for interactions with neurotransmitter systems, which could be relevant in the development of therapeutic agents. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₆H₂₀N₂O₂·ClH

InChI: InChI=1S/C16H20N2O2.ClH/c1-19-15-4-3-13(11-16(15)20-2)5-10-18-12-14-6-8-17-9-7-14;/h3-4,6-9,11,18H,5,10,12H2,1-2H3;1H

InChI key: InChIKey=DMCSXPXFQXTOAP-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC)C=CC(CCNCC=2C=CN=CC2)=C1.Cl

Synonyms:

• 4-Pyridinemethanamine, N-[2-(3,4-dimethoxyphenyl)ethyl]-, hydrochloride (1:1)