CAS 1185293-66-6

4-Piperidinemethanamine, 1-[(4-methoxyphenyl)methyl]-, hydrochloride (1:2)

Description:

4-Piperidinemethanamine, 1-[(4-methoxyphenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which contributes to its potential biological activity. The presence of a methoxyphenyl group enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including pharmaceuticals. This compound may exhibit properties such as being a potential neurotransmitter modulator or having effects on the central nervous system, although specific biological activities would depend on further empirical studies. Its molecular structure suggests it could participate in hydrogen bonding, which is significant for its solubility and reactivity. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry and drug development.

Formula: C₁₄H₂₂N₂O·2ClH

InChI: InChI=1S/C14H22N2O.2ClH/c1-17-14-4-2-13(3-5-14)11-16-8-6-12(10-15)7-9-16;;/h2-5,12H,6-11,15H2,1H3;2*1H

InChI key: InChIKey=SFXIFVBJCVDSQJ-UHFFFAOYSA-N

SMILES: C(C1=CC=C(OC)C=C1)N2CCC(CN)CC2.Cl

Synonyms:

• 4-Piperidinemethanamine, 1-[(4-methoxyphenyl)methyl]-, hydrochloride (1:2)