CymitQuimica logo

CAS 1185293-75-7

:

Quinoline, 1,2,3,4-tetrahydro-8-methoxy-, ethanedioate (1:1)

Description:
Quinoline, 1,2,3,4-tetrahydro-8-methoxy-, ethanedioate (1:1) is a chemical compound characterized by its unique structure, which includes a quinoline core modified with a tetrahydro group and a methoxy substituent. This compound typically exhibits properties associated with both quinoline derivatives and carboxylic acid salts due to the presence of the ethanedioate moiety. It is likely to be a solid at room temperature, with potential solubility in polar organic solvents. The methoxy group can influence its reactivity and polarity, while the tetrahydro structure may affect its biological activity and interaction with other molecules. Quinoline derivatives are known for their diverse applications, including use in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The specific characteristics, such as melting point, boiling point, and spectral data, would depend on the compound's purity and the conditions under which it is analyzed. As with many quinoline derivatives, it may exhibit fluorescence and have potential biological activities, making it of interest in medicinal chemistry.
Formula:C10H13NO·C2H2O4
InChI:InChI=1S/C10H13NO.C2H2O4/c1-12-9-6-2-4-8-5-3-7-11-10(8)9;3-1(4)2(5)6/h2,4,6,11H,3,5,7H2,1H3;(H,3,4)(H,5,6)
InChI key:InChIKey=MMOXSWAXNJXIIL-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC=C1)CCCN2.C(C(O)=O)(O)=O
Synonyms:
  • Quinoline, 1,2,3,4-tetrahydro-8-methoxy-, ethanedioate (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.