CAS 1185293-79-1

1H-Benzimidazole-2-methanol, 5-amino-1-ethyl-, hydrochloride (1:2)

Description:

1H-Benzimidazole-2-methanol, 5-amino-1-ethyl-, hydrochloride (1:2) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features an amino group and an ethyl substituent, contributing to its potential biological activity. The presence of the hydroxymethyl group at the 2-position enhances its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, which are common in benzimidazole derivatives. Its molecular interactions are influenced by the functional groups present, allowing for potential binding to biological targets. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its pharmacological profile and potential therapeutic uses.

Formula: C₁₀H₁₃N₃O·2ClH

InChI: InChI=1S/C10H13N3O.2ClH/c1-2-13-9-4-3-7(11)5-8(9)12-10(13)6-14;;/h3-5,14H,2,6,11H2,1H3;2*1H

InChI key: InChIKey=DINYUHOUQURPGH-UHFFFAOYSA-N

SMILES: C(C)N1C=2C(N=C1CO)=CC(N)=CC2.Cl

Synonyms:

• 1H-Benzimidazole-2-methanol, 5-amino-1-ethyl-, hydrochloride (1:2)