
CAS 1185293-99-5
:1-Pyrrolidineethanamine, β-(4-chlorophenyl)-, ethanedioate (2:1)
Description:
1-Pyrrolidineethanamine, β-(4-chlorophenyl)-, ethanedioate (2:1), identified by its CAS number 1185293-99-5, is a chemical compound that features a pyrrolidine ring and an ethylamine structure, with a β-(4-chlorophenyl) substituent. This compound is characterized by its potential biological activity, often studied in the context of pharmacology and medicinal chemistry. The presence of the 4-chlorophenyl group may influence its interaction with biological targets, potentially affecting its efficacy and selectivity. The ethanedioate (or oxalate) component indicates that the compound forms a salt or complex with oxalic acid, which can affect its solubility and stability. Generally, compounds of this nature may exhibit properties such as moderate to high solubility in polar solvents, and their behavior in biological systems can be influenced by factors such as pH and the presence of other ions. As with many organic compounds, safety and handling precautions are essential, given the potential for toxicity or reactivity. Further studies would be necessary to elucidate its specific applications and mechanisms of action.
Formula:C12H17ClN2C2H2O4
InChI:InChI=1S/C12H17ClN2.C2H2O4/c13-11-5-3-10(4-6-11)12(9-14)15-7-1-2-8-15;3-1(4)2(5)6/h3-6,12H,1-2,7-9,14H2;(H,3,4)(H,5,6)
InChI key:InChIKey=WOWFWJZCMDEOEX-UHFFFAOYSA-N
SMILES:C(CN)(C1=CC=C(Cl)C=C1)N2CCCC2.C(C(O)=O)(O)=O
Synonyms:- 1-Pyrrolidineethanamine, β-(4-chlorophenyl)-, ethanedioate (2:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.