CAS 1185294-01-2

2-Furancarboxamide, N-[2-[(3-pyridinylmethyl)amino]ethyl]-, hydrobromide (1:2)

Description:

2-Furancarboxamide, N-[2-[(3-pyridinylmethyl)amino]ethyl]-, hydrobromide (1:2) is a chemical compound characterized by its complex structure, which includes a furan ring and a pyridine moiety. The presence of the furan and pyridine groups suggests potential biological activity, as these heterocycles are often found in pharmacologically active compounds. The hydrobromide salt form indicates that the compound is likely to be soluble in water, which can enhance its bioavailability. The amide functional group contributes to the compound's stability and may influence its interaction with biological targets. This compound may exhibit properties such as moderate to high polarity due to the presence of nitrogen and oxygen atoms, which can participate in hydrogen bonding. Additionally, the specific arrangement of functional groups may confer unique reactivity and selectivity in chemical reactions. Overall, this compound's characteristics suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₃H₁₅N₃O₂·2BrH

InChI: InChI=1S/C13H15N3O2.2BrH/c17-13(12-4-2-8-18-12)16-7-6-15-10-11-3-1-5-14-9-11;;/h1-5,8-9,15H,6-7,10H2,(H,16,17);2*1H

InChI key: InChIKey=UZLIEXVJBNABSQ-UHFFFAOYSA-N

SMILES: C(NCCNCC=1C=CC=NC1)(=O)C2=CC=CO2.Br

Synonyms:

• 2-Furancarboxamide, N-[2-[(3-pyridinylmethyl)amino]ethyl]-, hydrobromide (1:2)