CAS 1185294-16-9

2-Furanmethanamine, N-(phenylmethyl)-α-2-propen-1-yl-, hydrochloride (1:1)

Description:

2-Furanmethanamine, N-(phenylmethyl)-α-2-propen-1-yl-, hydrochloride (1:1) is a chemical compound characterized by its furan and amine functional groups, which contribute to its reactivity and potential biological activity. The presence of the phenylmethyl group suggests that it may exhibit aromatic properties, while the α-2-propen-1-yl moiety indicates a vinyl group that can participate in various chemical reactions, such as polymerization or electrophilic addition. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. The compound may exhibit properties such as being a potential intermediate in organic synthesis or having specific pharmacological effects, although detailed studies would be necessary to elucidate its biological activity. Safety data and handling precautions should be considered, as with any chemical substance, particularly those with amine functionalities, which can be reactive and may pose health risks.

Formula: C₁₅H₁₇NO·ClH

InChI: InChI=1S/C15H17NO.ClH/c1-2-7-14(15-10-6-11-17-15)16-12-13-8-4-3-5-9-13;/h2-6,8-11,14,16H,1,7,12H2;1H

InChI key: InChIKey=XWXSWMGMOXGBAY-UHFFFAOYSA-N

SMILES: C(NCC1=CC=CC=C1)(CC=C)C2=CC=CO2.Cl

Synonyms:

• 2-Furanmethanamine, N-(phenylmethyl)-α-2-propen-1-yl-, hydrochloride (1:1)