CAS 1185294-45-4

Benzaldehyde, 3-fluoro-4-(1-piperazinyl)-, hydrochloride (1:1)

Description:

Benzaldehyde, 3-fluoro-4-(1-piperazinyl)-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a benzaldehyde moiety substituted with a fluorine atom and a piperazine ring. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and potentially influencing its biological activity. This compound may exhibit properties typical of both aromatic aldehydes and piperazine derivatives, such as potential reactivity in electrophilic aromatic substitution and interactions with biological targets due to the piperazine group. Its fluorine substitution can also impart unique electronic properties, affecting its reactivity and pharmacological profile. The compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperazine's role in enhancing bioactivity and the potential for the fluorine atom to modulate lipophilicity and metabolic stability. As with many such compounds, safety and handling precautions should be observed, given the potential for biological activity and toxicity.

Formula: C₁₁H₁₃FN₂O·ClH

InChI: InChI=1S/C11H13FN2O.ClH/c12-10-7-9(8-15)1-2-11(10)14-5-3-13-4-6-14;/h1-2,7-8,13H,3-6H2;1H

InChI key: InChIKey=DFJWOUDBSGXQOQ-UHFFFAOYSA-N

SMILES: FC1=C(C=CC(C=O)=C1)N2CCNCC2.Cl

Synonyms:

• Benzaldehyde, 3-fluoro-4-(1-piperazinyl)-, hydrochloride (1:1)