
CAS 1185294-46-5
:1-Piperazineethanol, 4-(2-methoxyphenyl)-α-[(methylamino)methyl]-, hydrochloride (1:3)
Description:
1-Piperazineethanol, 4-(2-methoxyphenyl)-α-[(methylamino)methyl]-, hydrochloride (1:3) is a chemical compound characterized by its piperazine and methoxyphenyl functional groups, which contribute to its potential biological activity. This substance is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous solutions. The presence of the piperazine ring suggests possible interactions with neurotransmitter systems, making it of interest in pharmacological research. The methoxyphenyl group may influence the compound's lipophilicity and receptor binding properties. As a hydrochloride salt, it is likely to exhibit improved stability and bioavailability compared to its free base form. The compound's structure indicates potential applications in medicinal chemistry, particularly in the development of therapeutics targeting central nervous system disorders. However, specific safety, toxicity, and handling information should be consulted from relevant safety data sheets and regulatory guidelines, as these factors are crucial for laboratory and clinical applications.
Formula:C15H25N3O2·3ClH
InChI:InChI=1S/C15H25N3O2.3ClH/c1-16-11-13(19)12-17-7-9-18(10-8-17)14-5-3-4-6-15(14)20-2;;;/h3-6,13,16,19H,7-12H2,1-2H3;3*1H
InChI key:InChIKey=WMVDYAYBTFITLS-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1)N2CCN(CC(CNC)O)CC2.Cl
Synonyms:- 1-Piperazineethanol, 4-(2-methoxyphenyl)-α-[(methylamino)methyl]-, hydrochloride (1:3)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.