
CAS 1185294-52-3
:2-Furanmethanamine, N,α-dimethyl-, ethanedioate (1:1)
Description:
2-Furanmethanamine, N,α-dimethyl-, ethanedioate (1:1), identified by its CAS number 1185294-52-3, is a chemical compound that features a furan ring, which is a five-membered aromatic heterocycle containing oxygen. This compound is characterized by the presence of a dimethylamino group attached to the furanmethanamine structure, indicating potential basic properties due to the nitrogen atom. The ethanedioate component suggests that it forms a salt or ester with oxalic acid, which may influence its solubility and reactivity. Generally, compounds of this nature can exhibit interesting biological activities and may be of interest in medicinal chemistry. The presence of both the furan and the dimethylamino functionalities may contribute to its potential as a ligand in coordination chemistry or as a precursor in organic synthesis. Additionally, the molecular structure may allow for various interactions, including hydrogen bonding and π-π stacking, which could affect its physical properties and applications in different fields, including pharmaceuticals and materials science.
Formula:C7H11NO·C2H2O4
InChI:InChI=1S/C7H11NO.C2H2O4/c1-6(8-2)7-4-3-5-9-7;3-1(4)2(5)6/h3-6,8H,1-2H3;(H,3,4)(H,5,6)
InChI key:InChIKey=RKTDYUVCAHOGFB-UHFFFAOYSA-N
SMILES:C(NC)(C)C1=CC=CO1.C(C(O)=O)(O)=O
Synonyms:- 2-Furanmethanamine, N,α-dimethyl-, ethanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.