
CAS 1185294-54-5
:2-Butanamine, 1-methoxy-3-methyl-, hydrochloride (1:1)
Description:
2-Butanamine, 1-methoxy-3-methyl-, hydrochloride (1:1) is an organic compound characterized by its amine functional group, which contributes to its basicity and potential reactivity. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in various applications, including pharmaceuticals. The presence of the methoxy and methyl groups indicates that this compound has branched alkyl chains, which can influence its steric properties and overall molecular interactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests potential for hydrogen bonding due to the amine group, which can affect its physical properties such as boiling point and solubility. Additionally, the hydrochloride form often stabilizes the compound, making it easier to handle and store. Safety data should be consulted for handling and exposure guidelines, as amines can be irritants and may pose health risks. Overall, this compound's unique structure and properties make it a subject of interest in various chemical and biological research fields.
Formula:C6H15NO·ClH
InChI:InChI=1S/C6H15NO.ClH/c1-5(2)6(7)4-8-3;/h5-6H,4,7H2,1-3H3;1H
InChI key:InChIKey=MELMFNVCMMMNKN-UHFFFAOYSA-N
SMILES:C(COC)(C(C)C)N.Cl
Synonyms:- 2-Butanamine, 1-methoxy-3-methyl-, hydrochloride (1:1)
- 1-Methoxy-3-methylbutan-2-amine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.