
CAS 1185294-55-6
:1H-Benzimidazole-2-ethanamine, 1-methyl-, hydrochloride (1:1)
Description:
1H-Benzimidazole-2-ethanamine, 1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features an ethylamine side chain and a methyl group attached to the nitrogen of the benzimidazole, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the hydrochloride group also indicates that it can act as a proton donor, which may influence its biological activity and interaction with other molecules. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C10H13N3·ClH
InChI:InChI=1S/C10H13N3.ClH/c1-13-9-5-3-2-4-8(9)12-10(13)6-7-11;/h2-5H,6-7,11H2,1H3;1H
InChI key:InChIKey=GAKQTDYDYWAAKV-UHFFFAOYSA-N
SMILES:CN1C=2C(N=C1CCN)=CC=CC2.Cl
Synonyms:- 1H-Benzimidazole-2-ethanamine, 1-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.