CAS 1185294-68-1

1(2H)-Azocinepropanoic acid, hexahydro-, hydrochloride (1:1)

Description:

1(2H)-Azocinepropanoic acid, hexahydro-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a hexahydroazocine ring fused with a propanoic acid moiety. This compound typically appears as a hydrochloride salt, indicating that it is a protonated form, which enhances its solubility in water and may influence its biological activity. The presence of the azocine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The hexahydro configuration indicates that the compound is fully saturated, which may contribute to its stability and reactivity. Additionally, the hydrochloride form often indicates a higher degree of stability and ease of handling in laboratory settings. Overall, this compound's characteristics, including its structural features and solubility properties, make it a subject of interest in various chemical and pharmaceutical research applications.

Formula: C₁₀H₁₉NO₂·ClH

InChI: InChI=1S/C10H19NO2.ClH/c12-10(13)6-9-11-7-4-2-1-3-5-8-11;/h1-9H2,(H,12,13);1H

InChI key: InChIKey=GOWQTWBVDFLXIV-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1CCCCCCC1.Cl

Synonyms:

• 1(2H)-Azocinepropanoic acid, hexahydro-, hydrochloride (1:1)