
CAS 1185294-75-0
:Piperidine, 3-[[(tetrahydro-2-furanyl)methoxy]methyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[[[tetrahydro-2-furanyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. The presence of the tetrahydro-2-furanyl group indicates that it contains a furan derivative, contributing to its unique properties. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological activity. The methoxy group attached to the tetrahydro-2-furanyl moiety suggests potential reactivity and interactions with biological targets. Piperidine derivatives are often studied for their applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to interact with various receptors and enzymes. The specific structural features of this compound may impart distinct biological activities, making it of interest in research related to neuropharmacology or other therapeutic areas. As with many piperidine derivatives, safety and handling precautions should be observed due to potential toxicity and reactivity.
Formula:C11H21NO2·ClH
InChI:InChI=1S/C11H21NO2.ClH/c1-3-10(7-12-5-1)8-13-9-11-4-2-6-14-11;/h10-12H,1-9H2;1H
InChI key:InChIKey=YTVWDOWKGSCDLO-UHFFFAOYSA-N
SMILES:C(OCC1CCCNC1)C2CCCO2.Cl
Synonyms:- Piperidine, 3-[[(tetrahydro-2-furanyl)methoxy]methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.