CAS 1185294-77-2

Benzonitrile, 2-[4-[(methylamino)methyl]phenoxy]-, hydrochloride (1:1)

Description:

Benzonitrile, 2-[4-[(methylamino)methyl]phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzonitrile moiety and a phenoxy group substituted with a methylamino group. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydrochloride salt form. The methylamino group contributes to its basicity, allowing it to form salts with acids, enhancing its solubility and stability. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or pathways. Its molecular interactions can be influenced by the presence of functional groups, which may affect its pharmacokinetic properties. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards.

Formula: C₁₅H₁₄N₂O·ClH

InChI: InChI=1S/C15H14N2O.ClH/c1-17-11-12-6-8-14(9-7-12)18-15-5-3-2-4-13(15)10-16;/h2-9,17H,11H2,1H3;1H

InChI key: InChIKey=SGNFNBBWBQJJPV-UHFFFAOYSA-N

SMILES: O(C1=C(C#N)C=CC=C1)C2=CC=C(CNC)C=C2.Cl

Synonyms:

• Benzonitrile, 2-[4-[(methylamino)methyl]phenoxy]-, hydrochloride (1:1)