
CAS 1185294-89-6
:Benzoic acid, 4-(1H-pyrazol-1-yl)-, hydrochloride (1:1)
Description:
Benzoic acid, 4-(1H-pyrazol-1-yl)-, hydrochloride (1:1) is a chemical compound characterized by its combination of a benzoic acid moiety and a pyrazole ring, which contributes to its unique properties. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water compared to its free base form. This compound typically exhibits acidic properties due to the carboxylic acid group, allowing it to participate in various chemical reactions, including esterification and amidation. Its pyrazole component may impart biological activity, making it of interest in pharmaceutical research. The molecular structure suggests potential interactions with biological targets, which could lead to applications in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a versatile structure with potential applications in both synthetic and medicinal chemistry.
Formula:C10H8N2O2·ClH
InChI:InChI=1S/C10H8N2O2.ClH/c13-10(14)8-2-4-9(5-3-8)12-7-1-6-11-12;/h1-7H,(H,13,14);1H
InChI key:InChIKey=TWRNPORUHDQYBO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(C=C1)N2C=CC=N2.Cl
Synonyms:- Benzoic acid, 4-(1H-pyrazol-1-yl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.