CymitQuimica logo

CAS 1185294-93-2

:

Benzenemethanamine, 3-(2-methylpyrazolo[1,5-a]pyrimidin-7-yl)-, hydrochloride (1:1)

Description:
Benzenemethanamine, 3-(2-methylpyrazolo[1,5-a]pyrimidin-7-yl)-, hydrochloride (1:1), with CAS number 1185294-93-2, is a chemical compound characterized by its complex structure, which includes a benzenemethanamine moiety and a 2-methylpyrazolo[1,5-a]pyrimidine group. This compound typically appears as a hydrochloride salt, indicating that it is soluble in water and may exhibit different properties compared to its free base form. The presence of the pyrazolo-pyrimidine structure suggests potential biological activity, possibly as a pharmaceutical agent, due to the known interactions of such heterocycles with biological targets. The compound's molecular interactions may be influenced by its amine functional group, which can participate in hydrogen bonding and affect its solubility and reactivity. Additionally, the hydrochloride form can enhance stability and facilitate handling in laboratory settings. Overall, this compound's unique structural features may contribute to its potential applications in medicinal chemistry and drug development.
Formula:C14H14N4·ClH
InChI:InChI=1S/C14H14N4.ClH/c1-10-7-14-16-6-5-13(18(14)17-10)12-4-2-3-11(8-12)9-15;/h2-8H,9,15H2,1H3;1H
InChI key:InChIKey=SVYPZQDCUNBXPQ-UHFFFAOYSA-N
SMILES:CC1=NN2C(=CC=NC2=C1)C3=CC(CN)=CC=C3.Cl
Synonyms:
  • Benzenemethanamine, 3-(2-methylpyrazolo[1,5-a]pyrimidin-7-yl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.