CAS 1185294-97-6

5-Isoxazolemethanamine, 3-ethyl-4,5-dihydro-, hydrochloride (1:1)

Description:

5-Isoxazolemethanamine, 3-ethyl-4,5-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its isoxazole ring structure, which contributes to its unique reactivity and potential biological activity. The presence of the dihydro form indicates that it has a saturated structure, which may influence its solubility and stability. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having specific pharmacological effects, although detailed biological activity would require further investigation. Its molecular structure suggests that it could interact with various biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound represents a class of organic molecules that could have significant implications in research and development within the fields of chemistry and pharmacology.

Formula: C₆H₁₂N₂O·ClH

InChI: InChI=1S/C6H12N2O.ClH/c1-2-5-3-6(4-7)9-8-5;/h6H,2-4,7H2,1H3;1H

InChI key: InChIKey=LDDPLKQLABUGHJ-UHFFFAOYSA-N

SMILES: C(C)C=1CC(CN)ON1.Cl

Synonyms:

• 5-Isoxazolemethanamine, 3-ethyl-4,5-dihydro-, hydrochloride (1:1)

[(3-ethyl-4,5-dihydro-5-isoxazolyl)methyl]amine hydrochloride

CAS: 1185294-97-6

Purity: 95.0%

Molecular weight: 164.6300048828125

Ref: 10-F360211

(3-Ethyl-4,5-dihydro-1,2-oxazol-5-yl)methanamine hydrochloride

CAS: 1185294-97-6

Versatile small molecule scaffold

Formula: C₆H₁₃ClN₂O

Purity: Min. 95%

Molecular weight: 164.63 g/mol

Ref: 3D-KXB29497