CAS 1185295-00-4

1H-Pyrazole-1-butanamide, 4-amino-N-methyl-, hydrochloride (1:1)

Description:

1H-Pyrazole-1-butanamide, 4-amino-N-methyl-, hydrochloride (1:1), with the CAS number 1185295-00-4, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two adjacent nitrogen atoms. This compound features a butanamide side chain and an amino group, contributing to its potential biological activity. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, which often enhances solubility in water and stability. The presence of the N-methyl group suggests that it may exhibit specific pharmacological properties, potentially influencing its interaction with biological targets. As a hydrochloride salt, it is likely to be more soluble in polar solvents, making it suitable for various applications in pharmaceutical research. The compound's unique structure may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential applications.

Formula: C₈H₁₄N₄O·ClH

InChI: InChI=1S/C8H14N4O.ClH/c1-10-8(13)3-2-4-12-6-7(9)5-11-12;/h5-6H,2-4,9H2,1H3,(H,10,13);1H

InChI key: InChIKey=OPGBVEXGECVMAV-UHFFFAOYSA-N

SMILES: C(CCC(NC)=O)N1N=CC(N)=C1.Cl

Synonyms:

• 1H-Pyrazole-1-butanamide, 4-amino-N-methyl-, hydrochloride (1:1)