CAS 1185295-06-0

1H-Indole-5-methanamine, N-(3-pyridinylmethyl)-, hydrochloride (1:2)

Description:

1H-Indole-5-methanamine, N-(3-pyridinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its indole and pyridine moieties, which contribute to its potential biological activity. The indole structure is a bicyclic compound known for its presence in many natural products and pharmaceuticals, while the pyridine ring adds to its heterocyclic nature, enhancing solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications in medicinal chemistry. The compound may exhibit properties such as being a potential ligand for biological targets, and its structural features suggest possible interactions with neurotransmitter systems. Its CAS number, 1185295-06-0, allows for precise identification in chemical databases. Overall, this compound's unique combination of functional groups and structural characteristics positions it as a candidate for further research in drug development and other chemical applications.

Formula: C₁₅H₁₅N₃·2ClH

InChI: InChI=1S/C15H15N3.2ClH/c1-2-13(10-16-6-1)11-17-9-12-3-4-15-14(8-12)5-7-18-15;;/h1-8,10,17-18H,9,11H2;2*1H

InChI key: InChIKey=ZWDXTPUBPSTSLC-UHFFFAOYSA-N

SMILES: C(NCC=1C=CC=NC1)C=2C=C3C(=CC2)NC=C3.Cl

Synonyms:

• 1H-Indole-5-methanamine, N-(3-pyridinylmethyl)-, hydrochloride (1:2)