
CAS 1185295-12-8
:1H-Indole-1-propanoic acid, 3-[(dimethylamino)methyl]-, acetate (1:1)
Description:
1H-Indole-1-propanoic acid, 3-[(dimethylamino)methyl]-, acetate (1:1), identified by CAS number 1185295-12-8, is a chemical compound that features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound contains a propanoic acid moiety and a dimethylamino group, contributing to its potential biological activity. The acetate form indicates that the compound is present as a salt or ester, which can influence its solubility and stability. Typically, compounds of this nature may exhibit properties such as moderate to high solubility in organic solvents and varying degrees of polarity, depending on the functional groups present. The presence of the dimethylamino group suggests potential interactions with biological systems, possibly influencing neurotransmitter pathways or other physiological processes. Overall, this compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting neurological or metabolic pathways. However, specific characteristics such as melting point, boiling point, and reactivity would require empirical data for precise information.
Formula:C14H18N2O2·C2H4O2
InChI:InChI=1S/C14H18N2O2.C2H4O2/c1-15(2)9-11-10-16(8-7-14(17)18)13-6-4-3-5-12(11)13;1-2(3)4/h3-6,10H,7-9H2,1-2H3,(H,17,18);1H3,(H,3,4)
InChI key:InChIKey=HCFKOMSXWBSHER-UHFFFAOYSA-N
SMILES:C(N(C)C)C=1C=2C(N(CCC(O)=O)C1)=CC=CC2.C(C)(O)=O
Synonyms:- 1H-Indole-1-propanoic acid, 3-[(dimethylamino)methyl]-, acetate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.