
CAS 1185295-16-2
:Benzenamine, 3-fluoro-4-(1-piperidinyl)-, hydrochloride (1:2)
Description:
Benzenamine, 3-fluoro-4-(1-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its aromatic amine structure, which includes a benzene ring substituted with a fluorine atom and a piperidine moiety. The presence of the piperidine group contributes to its potential biological activity, as piperidine derivatives are often found in pharmaceuticals. The hydrochloride salt form indicates that the compound is protonated, enhancing its solubility in water and making it suitable for various applications, including medicinal chemistry. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development, particularly in the context of neuropharmacology or other therapeutic areas. Its specific interactions, stability, and reactivity would depend on the functional groups present and the overall molecular structure. As with many amines, it may also participate in hydrogen bonding, influencing its physical and chemical properties. Safety and handling precautions should be observed due to the potential toxicity associated with amines and halogenated compounds.
Formula:C11H15FN2·2ClH
InChI:InChI=1S/C11H15FN2.2ClH/c12-10-8-9(13)4-5-11(10)14-6-2-1-3-7-14;;/h4-5,8H,1-3,6-7,13H2;2*1H
InChI key:InChIKey=LQFLNFLAXSYMNE-UHFFFAOYSA-N
SMILES:FC1=C(N2CCCCC2)C=CC(N)=C1.Cl
Synonyms:- Benzenamine, 3-fluoro-4-(1-piperidinyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.