CAS 1185295-18-4

5H-Thiazolo[3,2-a]pyrimidine-6-carboxylic acid, 5-oxo-, ethyl ester, hydrochloride (1:1)

Description:

5H-Thiazolo[3,2-a]pyrimidine-6-carboxylic acid, 5-oxo-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its thiazole and pyrimidine ring structures, which contribute to its biological activity. The presence of a carboxylic acid and an ester functional group suggests potential for reactivity and solubility in various solvents. The hydrochloride form indicates that the compound is a salt, which typically enhances its stability and solubility in aqueous solutions. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for interactions with biological targets, potentially influencing enzyme activity or receptor binding. As with many heterocyclic compounds, it may also display unique optical and electronic properties. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties and potential applications in research or industry.

Formula: C₉H₈N₂O₃S·ClH

InChI: InChI=1S/C9H8N2O3S.ClH/c1-2-14-8(13)6-5-10-9-11(7(6)12)3-4-15-9;/h3-5H,2H2,1H3;1H

InChI key: InChIKey=JHPMDNVLECWGDG-UHFFFAOYSA-N

SMILES: O=C1N2C(=NC=C1C(OCC)=O)SC=C2.Cl

Synonyms:

• 5H-Thiazolo[3,2-a]pyrimidine-6-carboxylic acid, 5-oxo-, ethyl ester, hydrochloride (1:1)