
CAS 1185295-20-8
:Benzenamine, 4-methyl-2-(3-methylbutoxy)-, hydrochloride (1:1)
Description:
Benzenamine, 4-methyl-2-(3-methylbutoxy)-, hydrochloride (1:1), with the CAS number 1185295-20-8, is an organic compound characterized by its amine functional group and aromatic structure. This substance features a benzene ring substituted with a methyl group and a 3-methylbutoxy group, which contributes to its hydrophobic properties. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals and organic synthesis. The presence of the amine group suggests potential basicity and reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Its molecular structure may influence its biological activity, making it of interest in medicinal chemistry. As with many amines, it may exhibit properties such as volatility and varying degrees of toxicity, necessitating careful handling and storage. Overall, this compound's unique structure and properties make it a subject of interest in both research and industrial applications.
Formula:C12H19NO·ClH
InChI:InChI=1S/C12H19NO.ClH/c1-9(2)6-7-14-12-8-10(3)4-5-11(12)13;/h4-5,8-9H,6-7,13H2,1-3H3;1H
InChI key:InChIKey=YSNJLMPJOIZSTB-UHFFFAOYSA-N
SMILES:O(CCC(C)C)C1=C(N)C=CC(C)=C1.Cl
Synonyms:- Benzenamine, 4-methyl-2-(3-methylbutoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.