CAS 1185295-24-2

2H-Benzimidazol-2-one, 5-amino-1,3-dihydro-6-methoxy-1,3-dimethyl-, hydrochloride (1:1)

Description:

2H-Benzimidazol-2-one, 5-amino-1,3-dihydro-6-methoxy-1,3-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features multiple functional groups, including an amino group and methoxy group, which contribute to its biological activity and solubility properties. The presence of the hydrochloride indicates that it is a salt form, enhancing its stability and solubility in aqueous environments. Typically, compounds of this nature may exhibit pharmacological properties, potentially acting as intermediates in drug synthesis or as active pharmaceutical ingredients. The molecular structure suggests that it may interact with biological targets, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the precise molecular interactions and the presence of substituents on the benzimidazole framework. Further studies would be necessary to elucidate its full biological profile and potential applications.

Formula: C₁₀H₁₃N₃O₂·ClH

InChI: InChI=1S/C10H13N3O2.ClH/c1-12-7-4-6(11)9(15-3)5-8(7)13(2)10(12)14;/h4-5H,11H2,1-3H3;1H

InChI key: InChIKey=SBGGEZOVGKDCMK-UHFFFAOYSA-N

SMILES: CN1C=2C(N(C)C1=O)=CC(N)=C(OC)C2.Cl

Synonyms:

• 2H-Benzimidazol-2-one, 5-amino-1,3-dihydro-6-methoxy-1,3-dimethyl-, hydrochloride (1:1)