CAS 1185295-25-3

1H-Pyrrolo[2,3-b]pyridine, 2-(4-piperidinyl)-, hydrochloride (1:2)

Description:

1H-Pyrrolo[2,3-b]pyridine, 2-(4-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a pyridine ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydrochloride salt form. The piperidine moiety contributes to its basicity and potential for forming hydrogen bonds, enhancing its solubility and reactivity. It is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where it may exhibit activity against various biological targets. The compound's molecular structure allows for potential interactions with neurotransmitter systems, making it of interest in the development of therapeutic agents. As with many chemical substances, handling should be conducted with care, adhering to safety protocols to mitigate any risks associated with its use.

Formula: C₁₂H₁₅N₃·2ClH

InChI: InChI=1S/C12H15N3.2ClH/c1-2-10-8-11(15-12(10)14-5-1)9-3-6-13-7-4-9;;/h1-2,5,8-9,13H,3-4,6-7H2,(H,14,15);2*1H

InChI key: InChIKey=HTOFEQOONPTXPU-UHFFFAOYSA-N

SMILES: C1(=CC=2C(N1)=NC=CC2)C3CCNCC3.Cl

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine, 2-(4-piperidinyl)-, hydrochloride (1:2)

2-Piperidin-4-yl-1H-pyrrolo[2,3-b]pyridinedihydrochloride

CAS: 1185295-25-3

Formula: C₁₂H₁₅N₃

Purity: ≥95%

Molecular weight: 201.2676

Ref: IN-DA008VT6