CAS 1185295-38-8

3-Piperidinecarboxylic acid, 1-[(2-methylphenyl)methyl]-, hydrochloride (1:1)

Description:

3-Piperidinecarboxylic acid, 1-[(2-methylphenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group, contributing to its acidity and potential for forming salts, such as the hydrochloride form indicated in its name. The presence of a 2-methylphenyl group attached to the piperidine nitrogen enhances its lipophilicity, potentially influencing its biological activity and solubility properties. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular interactions, including hydrogen bonding and steric effects due to the aromatic substituent, can significantly affect its reactivity and biological profile. Overall, this compound represents a unique structure with potential applications in various chemical and pharmaceutical contexts.

Formula: C₁₄H₁₉NO₂·ClH

InChI: InChI=1S/C14H19NO2.ClH/c1-11-5-2-3-6-12(11)9-15-8-4-7-13(10-15)14(16)17;/h2-3,5-6,13H,4,7-10H2,1H3,(H,16,17);1H

InChI key: InChIKey=PIQQCSJRMUQPJZ-UHFFFAOYSA-N

SMILES: C(N1CC(C(O)=O)CCC1)C2=C(C)C=CC=C2.Cl

Synonyms:

• 3-Piperidinecarboxylic acid, 1-[(2-methylphenyl)methyl]-, hydrochloride (1:1)