CAS 1185295-61-7

1,4-Benzoxazepine-4(5H)-acetic acid, 2,3-dihydro-, hydrochloride (1:1)

Description:

1,4-Benzoxazepine-4(5H)-acetic acid, 2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which includes a benzene ring fused to an oxazepine moiety. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the acetic acid group and the hydrochloride salt form. It is likely to be soluble in polar solvents, such as water and alcohols, owing to its ionic nature in the hydrochloride form. The compound may exhibit biological activity, potentially influencing neurotransmitter systems, which is common among benzoxazepine derivatives. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders. As with many chemical substances, safety and handling precautions should be observed, as the specific toxicity and reactivity profiles would depend on its concentration and formulation. Further studies would be necessary to fully elucidate its pharmacological properties and potential therapeutic uses.

Formula: C₁₁H₁₃NO₃·ClH

InChI: InChI=1S/C11H13NO3.ClH/c13-11(14)8-12-5-6-15-10-4-2-1-3-9(10)7-12;/h1-4H,5-8H2,(H,13,14);1H

InChI key: InChIKey=KMDHTTVCGHYVQX-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1CC=2C(OCC1)=CC=CC2.Cl

Synonyms:

• 1,4-Benzoxazepine-4(5H)-acetic acid, 2,3-dihydro-, hydrochloride (1:1)