CymitQuimica logo

CAS 1185295-67-3

:

3,5-Bis[2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]ethoxy]benzoic acid

Description:
3,5-Bis[2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]ethoxy]benzoic acid is a complex organic compound characterized by its multi-functional structure, which includes a benzoic acid moiety and fluorenylmethoxycarbonyl (Fmoc) protecting groups. This compound typically exhibits properties such as solubility in organic solvents, which is influenced by the presence of the fluorenyl group, and it may show limited solubility in water due to its hydrophobic characteristics. The Fmoc groups are commonly used in peptide synthesis as protective groups for amino acids, indicating that this compound may play a role in the synthesis of peptides or related biomolecules. Additionally, the presence of multiple ethoxy linkages suggests potential for hydrogen bonding and interactions with other molecules. Its molecular structure may confer specific reactivity, making it useful in various chemical applications, particularly in organic synthesis and medicinal chemistry. Overall, this compound's unique characteristics stem from its intricate arrangement of functional groups, which can influence its chemical behavior and applications in research and industry.
Formula:C41H36N2O8
InChI:InChI=1S/C41H36N2O8/c44-39(45)26-21-27(48-19-17-42-40(46)50-24-37-33-13-5-1-9-29(33)30-10-2-6-14-34(30)37)23-28(22-26)49-20-18-43-41(47)51-25-38-35-15-7-3-11-31(35)32-12-4-8-16-36(32)38/h1-16,21-23,37-38H,17-20,24-25H2,(H,42,46)(H,43,47)(H,44,45)
InChI key:InChIKey=SSXQWLIYCZHPAF-UHFFFAOYSA-N
SMILES:C(OC(NCCOC1=CC(OCCNC(OCC2C=3C(C=4C2=CC=CC4)=CC=CC3)=O)=CC(C(O)=O)=C1)=O)C5C=6C(C=7C5=CC=CC7)=CC=CC6
Synonyms:
  • 3,5-Bis[2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]ethoxy]benzoic acid
  • Benzoic acid, 3,5-bis[2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]ethoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.