CAS 1185295-87-7

2-[[(1,1-Dimethylethoxy)carbonyl]amino]-3,4-dimethylbenzoic acid

Description:

2-[[(1,1-Dimethylethoxy)carbonyl]amino]-3,4-dimethylbenzoic acid, with the CAS number 1185295-87-7, is a chemical compound characterized by its complex structure that includes a benzoic acid moiety substituted with both dimethyl and dimethylethoxy groups. This compound features an amino group that is acylated with a dimethylethoxycarbonyl group, which contributes to its unique reactivity and solubility properties. The presence of multiple methyl groups enhances its hydrophobic characteristics, while the carboxylic acid functional group provides acidic properties, allowing for potential interactions in various chemical environments. Its molecular structure suggests potential applications in pharmaceuticals, particularly in drug design, where modifications can influence biological activity and solubility. Additionally, the compound's stability and reactivity can be influenced by the steric hindrance introduced by the dimethyl groups, making it a subject of interest in synthetic organic chemistry. Overall, this compound exemplifies the intricate balance of functional groups that can dictate the behavior and utility of organic molecules in various applications.

Formula: C₁₄H₁₉NO₄

InChI: InChI=1S/C14H19NO4/c1-8-6-7-10(12(16)17)11(9(8)2)15-13(18)19-14(3,4)5/h6-7H,1-5H3,(H,15,18)(H,16,17)

InChI key: InChIKey=GDNHCMZHNNURST-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1=C(C(O)=O)C=CC(C)=C1C

Synonyms:

• Benzoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-3,4-dimethyl-
• 2-[[(1,1-Dimethylethoxy)carbonyl]amino]-3,4-dimethylbenzoic acid

2-((Tert-butoxycarbonyl)amino)-3,4-dimethylbenzoic acid

CAS: 1185295-87-7

2-((Tert-butoxycarbonyl)amino)-3,4-dimethylbenzoic acid

Purity: 97%

Molecular weight: 265.30g/mol

Ref: 54-OR79041

2-((Tert-butoxycarbonyl)amino)-3,4-dimethylbenzoic acid

CAS: 1185295-87-7

Purity: 97%

Molecular weight: 265.3089905

Ref: 10-F688107