CymitQuimica logo

CAS 1185296-12-1

:

Benzenamine, 2-methyl-4-(2-phenylethoxy)-, hydrochloride (1:1)

Description:
Benzenamine, 2-methyl-4-(2-phenylethoxy)-, hydrochloride (1:1), with the CAS number 1185296-12-1, is a chemical compound that belongs to the class of amines and is characterized by the presence of both an aromatic amine and an ether functional group. This compound features a benzene ring substituted with a methyl group and a phenylethoxy group, which contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and organic synthesis. The presence of the amine group suggests potential basicity and reactivity, making it suitable for further chemical transformations. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its structural complexity and functional groups may influence its physical properties, such as melting point, boiling point, and solubility, which are essential for understanding its behavior in different environments.
Formula:C15H17NO·ClH
InChI:InChI=1S/C15H17NO.ClH/c1-12-11-14(7-8-15(12)16)17-10-9-13-5-3-2-4-6-13;/h2-8,11H,9-10,16H2,1H3;1H
InChI key:InChIKey=RDZZXXJPSKURPF-UHFFFAOYSA-N
SMILES:O(CCC1=CC=CC=C1)C2=CC(C)=C(N)C=C2.Cl
Synonyms:
  • Benzenamine, 2-methyl-4-(2-phenylethoxy)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.