CAS 1185296-17-6

Benzenamine, 2-[2-(3-methoxyphenyl)ethyl]-, hydrochloride (1:1)

Description:

Benzenamine, 2-[2-(3-methoxyphenyl)ethyl]-, hydrochloride (1:1), also known as a specific type of substituted aniline, is characterized by its amine functional group attached to a benzene ring, along with an ethyl chain that connects to a methoxy-substituted phenyl group. This compound typically appears as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The presence of the methoxy group contributes to its electronic properties, potentially affecting its reactivity and interaction with biological targets. As a hydrochloride, it is likely to be a white crystalline solid, and its stability can be influenced by factors such as pH and temperature. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific applications and safety profiles would require further investigation and analysis.

Formula: C₁₅H₁₇NO·ClH

InChI: InChI=1S/C15H17NO.ClH/c1-17-14-7-4-5-12(11-14)9-10-13-6-2-3-8-15(13)16;/h2-8,11H,9-10,16H2,1H3;1H

InChI key: InChIKey=SDEWQKXSRLZCTC-UHFFFAOYSA-N

SMILES: C(CC1=C(N)C=CC=C1)C2=CC(OC)=CC=C2.Cl

Synonyms:

• Benzenamine, 2-[2-(3-methoxyphenyl)ethyl]-, hydrochloride (1:1)