CAS 1185296-35-8

4-Piperidinemethanamine, 1-[(2-fluorophenyl)methyl]-N-(2-methoxyethyl)-, hydrochloride (1:2)

Description:

4-Piperidinemethanamine, 1-[(2-fluorophenyl)methyl]-N-(2-methoxyethyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which contributes to its potential biological activity. The presence of a 2-fluorophenyl group indicates that it may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. The methoxyethyl substituent enhances its solubility and may affect its lipophilicity, which is crucial for membrane permeability and bioavailability. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including medicinal chemistry and drug formulation. The compound's molecular structure suggests potential use in therapeutic contexts, possibly as a drug candidate, although specific biological activities and mechanisms would require further investigation. Safety and handling precautions should be observed due to the potential for biological activity, and its use should comply with relevant regulations and guidelines.

Formula: C₁₆H₂₅FN₂O·2ClH

InChI: InChI=1S/C16H25FN2O.2ClH/c1-20-11-8-18-12-14-6-9-19(10-7-14)13-15-4-2-3-5-16(15)17;;/h2-5,14,18H,6-13H2,1H3;2*1H

InChI key: InChIKey=NYKHJNMDXIOHKV-UHFFFAOYSA-N

SMILES: C(C1=C(F)C=CC=C1)N2CCC(CNCCOC)CC2.Cl

Synonyms:

• 4-Piperidinemethanamine, 1-[(2-fluorophenyl)methyl]-N-(2-methoxyethyl)-, hydrochloride (1:2)