CAS 1185296-53-0

4-Piperidinamine, 1-[(3-fluorophenyl)methyl]-, hydrochloride (1:2)

Description:

4-Piperidinamine, 1-[(3-fluorophenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 3-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, influencing the compound's electronic properties and potentially its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having pharmacological significance, possibly acting on specific biological targets due to its amine functionality. The molecular structure suggests it could participate in hydrogen bonding, which is crucial for interactions with biological macromolecules. Safety and handling precautions should be observed, as with many amines and their derivatives, due to potential toxicity and reactivity. Further studies would be necessary to fully elucidate its properties and applications in medicinal chemistry.

Formula: C₁₂H₁₇FN₂·2ClH

InChI: InChI=1S/C12H17FN2.2ClH/c13-11-3-1-2-10(8-11)9-15-6-4-12(14)5-7-15;;/h1-3,8,12H,4-7,9,14H2;2*1H

InChI key: InChIKey=ISNPZTRVPPAIKE-UHFFFAOYSA-N

SMILES: C(C1=CC(F)=CC=C1)N2CCC(N)CC2.Cl

Synonyms:

• 4-Piperidinamine, 1-[(3-fluorophenyl)methyl]-, hydrochloride (1:2)

1-(3-Fluorobenzyl)piperidin-4-amine dihydrochloride

CAS: 1185296-53-0

Versatile small molecule scaffold

Formula: C₁₂H₁₉Cl₂FN₂

Purity: Min. 95%

Molecular weight: 281.19 g/mol

Ref: 3D-KXB29653