
CAS 1185296-75-6
:4-Piperidinemethanamine, 1-methyl-, hydrochloride (1:1)
Description:
4-Piperidinemethanamine, 1-methyl-, hydrochloride (1:1), commonly referred to as a piperidine derivative, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a methyl group attached to the nitrogen atom and an amine functional group, contributing to its basicity and potential reactivity. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water, making it suitable for various applications in pharmaceuticals and organic synthesis. The presence of the hydrochloride indicates that it can form stable salts, which are often more manageable in handling and storage. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions. Its properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and usage guidelines.
Formula:C7H16N2·ClH
InChI:InChI=1S/C7H16N2.ClH/c1-9-4-2-7(6-8)3-5-9;/h7H,2-6,8H2,1H3;1H
InChI key:InChIKey=XEFFFJHYAWLMRI-UHFFFAOYSA-N
SMILES:C(N)C1CCN(C)CC1.Cl
Synonyms:- (1-Methylpiperidin-4-yl)methanamine hydrochloride
- 4-Piperidinemethanamine, 1-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.