CymitQuimica logo

CAS 1185296-78-9

:

Piperazine, 3-methyl-1-(4-methylphenyl)-, hydrochloride (1:2)

Description:
Piperazine, 3-methyl-1-(4-methylphenyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic structure containing two nitrogen atoms. This specific derivative features a methyl group at the 3-position and a para-methylphenyl group at the 1-position, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water, making it suitable for various applications, including pharmaceuticals. The compound may exhibit biological activity, potentially influencing neurotransmitter systems due to its structural similarity to other piperazine derivatives. Its molecular interactions can be significant in medicinal chemistry, particularly in the development of therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a specific class of piperazine derivatives with potential applications in drug development and research.
Formula:C12H18N2·2ClH
InChI:InChI=1S/C12H18N2.2ClH/c1-10-3-5-12(6-4-10)14-8-7-13-11(2)9-14;;/h3-6,11,13H,7-9H2,1-2H3;2*1H
InChI key:InChIKey=PFPDFAIBCQXSFW-UHFFFAOYSA-N
SMILES:CC1CN(CCN1)C2=CC=C(C)C=C2.Cl
Synonyms:
  • Piperazine, 3-methyl-1-(4-methylphenyl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.