CAS 1185296-81-4

Thiazolidine, 2-(3,4,5-trimethoxyphenyl)-, hydrochloride (1:1)

Description:

Thiazolidine, 2-(3,4,5-trimethoxyphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its thiazolidine ring structure, which is a five-membered heterocyclic compound containing both sulfur and nitrogen atoms. The presence of the 3,4,5-trimethoxyphenyl group indicates that the compound has three methoxy (-OCH3) substituents on a phenyl ring, contributing to its potential biological activity and solubility properties. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The compound may exhibit various pharmacological properties, potentially including anti-inflammatory or antidiabetic effects, owing to the thiazolidine framework commonly associated with such activities. Its specific interactions, mechanisms of action, and therapeutic uses would require further investigation through experimental studies. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.

Formula: C₁₂H₁₇NO₃S·ClH

InChI: InChI=1S/C12H17NO3S.ClH/c1-14-9-6-8(12-13-4-5-17-12)7-10(15-2)11(9)16-3;/h6-7,12-13H,4-5H2,1-3H3;1H

InChI key: InChIKey=ROAYGVGGCSCHET-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(C=C(OC)C1OC)C2NCCS2.Cl

Synonyms:

• Thiazolidine, 2-(3,4,5-trimethoxyphenyl)-, hydrochloride (1:1)