CAS 1185296-83-6

1H-Imidazole-1-ethanol, α-[(4-aminophenoxy)methyl]-, ethanedioate (1:2)

Description:

1H-Imidazole-1-ethanol, α-[(4-aminophenoxy)methyl]-, ethanedioate (1:2) is a chemical compound characterized by its imidazole ring structure, which contributes to its potential biological activity. The presence of the ethanol group suggests it has hydroxyl functionality, enhancing its solubility in polar solvents and possibly influencing its reactivity. The α-[(4-aminophenoxy)methyl] substituent indicates that the compound has an aromatic amine moiety, which may impart additional properties such as increased reactivity or interaction with biological targets. The ethanedioate (oxalate) component indicates that the compound forms a salt or complex, which can affect its stability and solubility. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its specific applications and behavior would depend on the context of its use, including potential interactions with biological systems or other chemical entities.

Formula: C₁₂H₁₅N₃O₂·2C₂H₂O₄

InChI: InChI=1S/C12H15N3O2.C2H2O4/c13-10-1-3-12(4-2-10)17-8-11(16)7-15-6-5-14-9-15;3-1(4)2(5)6/h1-6,9,11,16H,7-8,13H2;(H,3,4)(H,5,6)

InChI key: InChIKey=KAOQEYOAFGMSIY-UHFFFAOYSA-N

SMILES: C(C(COC1=CC=C(N)C=C1)O)N2C=CN=C2.C(C(O)=O)(O)=O

Synonyms:

• 1H-Imidazole-1-ethanol, α-[(4-aminophenoxy)methyl]-, ethanedioate (1:2)