CAS 1185296-89-2

2-Furanmethanamine, tetrahydro-N-(1-methyl-3-phenylpropyl)-, hydrochloride (1:1)

Description:

2-Furanmethanamine, tetrahydro-N-(1-methyl-3-phenylpropyl)-, hydrochloride (1:1) is a chemical compound characterized by its furan and amine functional groups, which contribute to its reactivity and potential biological activity. The presence of the tetrahydro moiety indicates that the compound contains a saturated cyclic structure, which may influence its pharmacokinetic properties. The hydrochloride form suggests that it is a salt, enhancing its solubility in aqueous solutions, which is often beneficial for pharmaceutical applications. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its interaction with biological targets. Additionally, the presence of the phenylpropyl group may impart lipophilicity, potentially influencing its ability to cross biological membranes. Overall, the structural features of this compound suggest it may have applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₅H₂₃NO·ClH

InChI: InChI=1S/C15H23NO.ClH/c1-13(16-12-15-8-5-11-17-15)9-10-14-6-3-2-4-7-14;/h2-4,6-7,13,15-16H,5,8-12H2,1H3;1H

InChI key: InChIKey=FXCIDNIQBFLVRI-UHFFFAOYSA-N

SMILES: C(CC(NCC1CCCO1)C)C2=CC=CC=C2.Cl

Synonyms:

• 2-Furanmethanamine, tetrahydro-N-(1-methyl-3-phenylpropyl)-, hydrochloride (1:1)