CAS 1185296-91-6

Benzenamine, 4-[2-(2-methoxyphenyl)ethyl]-, hydrochloride (1:1)

Description:

Benzenamine, 4-[2-(2-methoxyphenyl)ethyl]-, hydrochloride (1:1), also known as 4-(2-(2-methoxyphenyl)ethyl)aniline hydrochloride, is a chemical compound characterized by its amine functional group and aromatic structure. It features a benzene ring substituted with an aniline group and a 2-(2-methoxyphenyl)ethyl side chain, contributing to its potential biological activity. The hydrochloride form indicates that it is a salt, which enhances its solubility in water, making it suitable for various applications, including pharmaceutical formulations. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having specific interactions in biological systems. Its molecular structure suggests it could participate in hydrogen bonding due to the presence of the amine group, influencing its reactivity and solubility. Safety data and handling precautions should be considered, as with any chemical substance, particularly in laboratory or industrial settings. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₅H₁₇NO·ClH

InChI: InChI=1S/C15H17NO.ClH/c1-17-15-5-3-2-4-13(15)9-6-12-7-10-14(16)11-8-12;/h2-5,7-8,10-11H,6,9,16H2,1H3;1H

InChI key: InChIKey=SZZVKCWGFNBUDU-UHFFFAOYSA-N

SMILES: C(CC1=CC=C(N)C=C1)C2=C(OC)C=CC=C2.Cl

Synonyms:

• Benzenamine, 4-[2-(2-methoxyphenyl)ethyl]-, hydrochloride (1:1)