CymitQuimica logo

CAS 1185297-07-7

:

Piperidine, 4-(2,4-dichloro-3,5-dimethylphenoxy)-, hydrochloride (1:1)

Description:
Piperidine, 4-(2,4-dichloro-3,5-dimethylphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a phenoxy group substituted with two chlorine atoms and two methyl groups, contributing to its unique chemical properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. This compound may exhibit biological activity, potentially influencing various pharmacological pathways, although specific biological effects would depend on its interaction with biological targets. The presence of the dichloro and dimethyl substituents can affect the compound's lipophilicity and reactivity, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C13H17Cl2NO·ClH
InChI:InChI=1S/C13H17Cl2NO.ClH/c1-8-7-11(13(15)9(2)12(8)14)17-10-3-5-16-6-4-10;/h7,10,16H,3-6H2,1-2H3;1H
InChI key:InChIKey=JGHZPZIGPAGMPP-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C(C)=C(Cl)C(C)=C1)C2CCNCC2.Cl
Synonyms:
  • Piperidine, 4-(2,4-dichloro-3,5-dimethylphenoxy)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.