CAS 1185297-14-6

1H-Pyrazole-4-methanamine, 3-phenyl-, hydrochloride (1:2)

Description:

1H-Pyrazole-4-methanamine, 3-phenyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a methanamine group at the 4-position and a phenyl group at the 3-position of the pyrazole ring, contributing to its unique reactivity and potential biological activity. The hydrochloride form indicates that the compound is a salt, which enhances its solubility in water and may influence its pharmacokinetic properties. Typically, such compounds are of interest in medicinal chemistry due to their potential as pharmaceuticals or agrochemicals. The presence of both nitrogen atoms in the pyrazole ring and the amine group suggests that the compound may engage in hydrogen bonding, which can affect its interactions with biological targets. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility can vary based on the purity and specific conditions under which the compound is studied.

Formula: C₁₀H₁₁N₃·2ClH

InChI: InChI=1S/C10H11N3.2ClH/c11-6-9-7-12-13-10(9)8-4-2-1-3-5-8;;/h1-5,7H,6,11H2,(H,12,13);2*1H

InChI key: InChIKey=PHSGANGGJOEOJO-UHFFFAOYSA-N

SMILES: C(N)C=1C(=NNC1)C2=CC=CC=C2.Cl

Synonyms:

• 1H-Pyrazole-4-methanamine, 3-phenyl-, hydrochloride (1:2)

[(3-phenyl-1H-pyrazol-4-yl)methyl]amine dihydrochloride

CAS: 1185297-14-6

Formula: C₁₀H₁₃Cl₂N₃

Purity: 95.0%

Molecular weight: 246.14

Ref: 10-F385895