
CAS 1185297-18-0
:Benzenamine, 4-[2-(phenylmethyl)phenoxy]-, hydrochloride (1:1)
Description:
Benzenamine, 4-[2-(phenylmethyl)phenoxy]-, hydrochloride (1:1), also known as a specific type of substituted aniline, is characterized by its structural features that include a benzene ring substituted with an amine group and a phenoxy group linked to a phenylmethyl moiety. This compound typically exhibits properties associated with both aromatic amines and ether functionalities, which can influence its solubility and reactivity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and organic synthesis. The presence of the amine group suggests potential basicity, while the aromatic rings contribute to its stability and potential for π-π stacking interactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as many aromatic amines can pose health risks. Overall, this compound's unique structure and properties make it a subject of interest in both research and industrial applications.
Formula:C19H17NO·ClH
InChI:InChI=1S/C19H17NO.ClH/c20-17-10-12-18(13-11-17)21-19-9-5-4-8-16(19)14-15-6-2-1-3-7-15;/h1-13H,14,20H2;1H
InChI key:InChIKey=PKJNZQKYSMCUGE-UHFFFAOYSA-N
SMILES:O(C1=C(CC2=CC=CC=C2)C=CC=C1)C3=CC=C(N)C=C3.Cl
Synonyms:- Benzenamine, 4-[2-(phenylmethyl)phenoxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.